C22H31ClO2 — CID 11682052
(4aR,4bS,6aS,7R,10aS,10bR,11R)-8-chloro-7-ethyl-7-hydroxy-6a,11-dimethyl-4,4a,4b,5,6,10,10a,10b,11,12-decahydro-3H-chrysen-2-one (PubChem CID 11682052) has the molecular formula C22H31ClO2 and a molecular weight of 362.94 g/mol. Its IUPAC name is (4aR,4bS,6aS,7R,10aS,10bR,11R)-8-chloro-7-ethyl-7-hydroxy-6a,11-dimethyl-4,4a,4b,5,6,10,10a,10b,11,12-decahydro-3H-chrysen-2-one.
| Compound Name | (4aR,4bS,6aS,7R,10aS,10bR,11R)-8-chloro-7-ethyl-7-hydroxy-6a,11-dimethyl-4,4a,4b,5,6,10,10a,10b,11,12-decahydro-3H-chrysen-2-one |
|---|---|
| PubChem CID | 11682052 |
| Molecular Formula | C22H31ClO2 |
| Molecular Weight | 362.94 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | (4aR,4bS,6aS,7R,10aS,10bR,11R)-8-chloro-7-ethyl-7-hydroxy-6a,11-dimethyl-4,4a,4b,5,6,10,10a,10b,11,12-decahydro-3H-chrysen-2-one |
| SMILES | CC[C@]1(O)C(Cl)=CC[C@H]2[C@H]3[C@H](CC[C@@]21C)[C@H]1CCC(=O)C=C1C[C@H]3C |
| InChI | InChI=1S/C22H31ClO2/c1-4-22(25)19(23)8-7-18-20-13(2)11-14-12-15(24)5-6-16(14)17(20)9-10-21(18,22)3/h8,12-13,16-18,20,25H,4-7,9-11H2,1-3H3/t13-,16+,17-,18+,20-,21+,22+/m1/s1 |
| InChIKey | CUNIIXFVKPEGCY-MHMFLHJCSA-N |
| XLogP | 5.25 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.94 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |