C24H36O3 — CID 166888663
(7,10,13-trimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) butanoate (PubChem CID 166888663) has the molecular formula C24H36O3 and a molecular weight of 372.55 g/mol. Its IUPAC name is (7,10,13-trimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) butanoate.
| Compound Name | (7,10,13-trimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) butanoate |
|---|---|
| PubChem CID | 166888663 |
| Molecular Formula | C24H36O3 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | (7,10,13-trimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) butanoate |
| SMILES | CCCC(=O)OC1CCC2C3C(C)CC4=CC(=O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C24H36O3/c1-5-6-21(26)27-20-8-7-18-22-15(2)13-16-14-17(25)9-11-23(16,3)19(22)10-12-24(18,20)4/h14-15,18-20,22H,5-13H2,1-4H3 |
| InChIKey | UCXUXYXBKVSLBY-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |