C24H34O4 — CID 88812986
[(8S,9R,10S,13S,14S)-10-formyl-1,7,13-trimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] propanoate (PubChem CID 88812986) has the molecular formula C24H34O4 and a molecular weight of 386.53 g/mol. Its IUPAC name is [(8S,9R,10S,13S,14S)-10-formyl-1,7,13-trimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] propanoate.
| Compound Name | [(8S,9R,10S,13S,14S)-10-formyl-1,7,13-trimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] propanoate |
|---|---|
| PubChem CID | 88812986 |
| Molecular Formula | C24H34O4 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | [(8S,9R,10S,13S,14S)-10-formyl-1,7,13-trimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] propanoate |
| SMILES | CCC(=O)OC1CC[C@H]2[C@@H]3C(C)CC4=CC(=O)CC(C)[C@]4(C=O)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C24H34O4/c1-5-21(27)28-20-7-6-18-22-14(2)10-16-12-17(26)11-15(3)24(16,13-25)19(22)8-9-23(18,20)4/h12-15,18-20,22H,5-11H2,1-4H3/t14?,15?,18-,19+,20?,22-,23-,24-/m0/s1 |
| InChIKey | GDKZOHZWLWXXMJ-CNCNPDHMSA-N |
| XLogP | 4.51 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|