C22H32O4 — CID 70541975
[(8R,9R,10S,13S,14S)-10-(hydroxymethyl)-13-methyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] propanoate (PubChem CID 70541975) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is [(8R,9R,10S,13S,14S)-10-(hydroxymethyl)-13-methyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] propanoate.
| Compound Name | [(8R,9R,10S,13S,14S)-10-(hydroxymethyl)-13-methyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] propanoate |
|---|---|
| PubChem CID | 70541975 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | [(8R,9R,10S,13S,14S)-10-(hydroxymethyl)-13-methyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] propanoate |
| SMILES | CCC(=O)OC1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(CO)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C22H32O4/c1-3-20(25)26-19-7-6-17-16-5-4-14-12-15(24)8-11-22(14,13-23)18(16)9-10-21(17,19)2/h12,16-19,23H,3-11,13H2,1-2H3/t16-,17-,18+,19?,21-,22+/m0/s1 |
| InChIKey | QECOHBMOLGQHQM-IODWBBHZSA-N |
| XLogP | 3.81 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |