C22H32O4 — CID 542246
[10-(methoxymethyl)-13-methyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 542246) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is [10-(methoxymethyl)-13-methyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [10-(methoxymethyl)-13-methyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 542246 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | [10-(methoxymethyl)-13-methyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | COCC12CCC(=O)C=C1CCC1C2CCC2(C)C(OC(C)=O)CCC12 |
| InChI | InChI=1S/C22H32O4/c1-14(23)26-20-7-6-18-17-5-4-15-12-16(24)8-11-22(15,13-25-3)19(17)9-10-21(18,20)2/h12,17-20H,4-11,13H2,1-3H3 |
| InChIKey | ZFTATJNZLAVIBB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |