C23H34O3 — CID 163682704
(9S,14S,17S)-10-(methoxymethyl)-13-methyl-17-propanoyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 163682704) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is (9S,14S,17S)-10-(methoxymethyl)-13-methyl-17-propanoyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (9S,14S,17S)-10-(methoxymethyl)-13-methyl-17-propanoyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 163682704 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | (9S,14S,17S)-10-(methoxymethyl)-13-methyl-17-propanoyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CCC(=O)[C@H]1CC[C@H]2C3CCC4=CC(=O)CCC4(COC)[C@H]3CCC12C |
| InChI | InChI=1S/C23H34O3/c1-4-21(25)20-8-7-18-17-6-5-15-13-16(24)9-12-23(15,14-26-3)19(17)10-11-22(18,20)2/h13,17-20H,4-12,14H2,1-3H3/t17?,18-,19-,20+,22?,23?/m0/s1 |
| InChIKey | JMDJCKCGGXCRKT-SRLAKGABSA-N |
| XLogP | 4.74 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |