C23H32O3 — CID 163008535
(17-ethenyl-13-methyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-10-yl)methyl acetate (PubChem CID 163008535) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is (17-ethenyl-13-methyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-10-yl)methyl acetate.
| Compound Name | (17-ethenyl-13-methyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-10-yl)methyl acetate |
|---|---|
| PubChem CID | 163008535 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | (17-ethenyl-13-methyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-10-yl)methyl acetate |
| SMILES | C=CC1CCC2C3CCC4=CC(=O)CCC4(COC(C)=O)C3CCC12C |
| InChI | InChI=1S/C23H32O3/c1-4-16-6-8-20-19-7-5-17-13-18(25)9-12-23(17,14-26-15(2)24)21(19)10-11-22(16,20)3/h4,13,16,19-21H,1,5-12,14H2,2-3H3 |
| InChIKey | AQMPQXUSCXRGBI-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|