C34H58O2Sn — CID 177383696
(7R,8R,9S,10R,13S,14S,17R)-17-hydroxy-7,10,13-trimethyl-17-[(Z)-2-tributylstannylethenyl]-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 177383696) has the molecular formula C34H58O2Sn and a molecular weight of 617.55 g/mol. Its IUPAC name is (7R,8R,9S,10R,13S,14S,17R)-17-hydroxy-7,10,13-trimethyl-17-[(Z)-2-tributylstannylethenyl]-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (7R,8R,9S,10R,13S,14S,17R)-17-hydroxy-7,10,13-trimethyl-17-[(Z)-2-tributylstannylethenyl]-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 177383696 |
| Molecular Formula | C34H58O2Sn |
| Molecular Weight | 617.55 g/mol |
| Exact Mass | 618.35 |
| IUPAC Name | (7R,8R,9S,10R,13S,14S,17R)-17-hydroxy-7,10,13-trimethyl-17-[(Z)-2-tributylstannylethenyl]-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CCCC[Sn](/C=C\[C@]1(O)CC[C@H]2[C@@H]3[C@H](C)CC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@@]21C)(CCCC)CCCC |
| InChI | InChI=1S/C22H31O2.3C4H9.Sn/c1-5-22(24)11-8-18-19-14(2)12-15-13-16(23)6-9-20(15,3)17(19)7-10-21(18,22)4;3*1-3-4-2;/h1,5,13-14,17-19,24H,6-12H2,2-4H3;3*1,3-4H2,2H3;/t14-,17+,18+,19-,20+,21+,22+;;;;/m1..../s1 |
| InChIKey | MLUOMRWGMOAHOG-URSDKPAHSA-N |
| XLogP | 9.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.55 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |