C22H29ClO2 — CID 88728329
2-[(10R,13S)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ylidene]propanoyl chloride (PubChem CID 88728329) has the molecular formula C22H29ClO2 and a molecular weight of 360.93 g/mol. Its IUPAC name is 2-[(10R,13S)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ylidene]propanoyl chloride.
| Compound Name | 2-[(10R,13S)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ylidene]propanoyl chloride |
|---|---|
| PubChem CID | 88728329 |
| Molecular Formula | C22H29ClO2 |
| Molecular Weight | 360.93 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | 2-[(10R,13S)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ylidene]propanoyl chloride |
| SMILES | CC(C(=O)Cl)=C1CCC2C3CCC4=CC(=O)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C22H29ClO2/c1-13(20(23)25)17-6-7-18-16-5-4-14-12-15(24)8-10-21(14,2)19(16)9-11-22(17,18)3/h12,16,18-19H,4-11H2,1-3H3/t16?,18?,19?,21-,22+/m0/s1 |
| InChIKey | VSOQBMAEDDWHFN-FNPUGNHUSA-N |
| XLogP | 5.60 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.93 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|