C23H29NO3 — CID 70635408
(3Z)-3-cyano-3-[(8R,9S,10R,13S,14S)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ylidene]propanoic acid (PubChem CID 70635408) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is (3Z)-3-cyano-3-[(8R,9S,10R,13S,14S)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ylidene]propanoic acid.
| Compound Name | (3Z)-3-cyano-3-[(8R,9S,10R,13S,14S)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ylidene]propanoic acid |
|---|---|
| PubChem CID | 70635408 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | (3Z)-3-cyano-3-[(8R,9S,10R,13S,14S)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ylidene]propanoic acid |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2CC[C@]2(C)/C(=C(\C#N)CC(=O)O)CC[C@@H]12 |
| InChI | InChI=1S/C23H29NO3/c1-22-9-7-16(25)12-15(22)3-4-17-19-6-5-18(14(13-24)11-21(26)27)23(19,2)10-8-20(17)22/h12,17,19-20H,3-11H2,1-2H3,(H,26,27)/b18-14-/t17-,19-,20-,22-,23+/m0/s1 |
| InChIKey | NBJSXNNEBOFFEG-VEEZNVPJSA-N |
| XLogP | 4.81 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|