C27H34O3Se — CID 135049267
[(8R,9S,10R,13S,14S,17S)-10,13,17-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] phenylselanylformate (PubChem CID 135049267) has the molecular formula C27H34O3Se and a molecular weight of 485.53 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S,17S)-10,13,17-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] phenylselanylformate.
| Compound Name | [(8R,9S,10R,13S,14S,17S)-10,13,17-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] phenylselanylformate |
|---|---|
| PubChem CID | 135049267 |
| Molecular Formula | C27H34O3Se |
| Molecular Weight | 485.53 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | [(8R,9S,10R,13S,14S,17S)-10,13,17-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] phenylselanylformate |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@]2(C)OC(=O)[Se]c1ccccc1 |
| InChI | InChI=1S/C27H34O3Se/c1-25-14-11-19(28)17-18(25)9-10-21-22(25)12-15-26(2)23(21)13-16-27(26,3)30-24(29)31-20-7-5-4-6-8-20/h4-8,17,21-23H,9-16H2,1-3H3/t21-,22+,23+,25+,26+,27+/m1/s1 |
| InChIKey | NXTHVXUNQRQRML-LJHIYBGHSA-N |
| XLogP | 5.44 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.53 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|