C28H35F5O2Si — CID 625149
17-[dimethyl-(2,3,4,5,6-pentafluorophenyl)silyl]oxy-10,13,17-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 625149) has the molecular formula C28H35F5O2Si and a molecular weight of 526.66 g/mol. Its IUPAC name is 17-[dimethyl-(2,3,4,5,6-pentafluorophenyl)silyl]oxy-10,13,17-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | 17-[dimethyl-(2,3,4,5,6-pentafluorophenyl)silyl]oxy-10,13,17-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 625149 |
| Molecular Formula | C28H35F5O2Si |
| Molecular Weight | 526.66 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | 17-[dimethyl-(2,3,4,5,6-pentafluorophenyl)silyl]oxy-10,13,17-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC12CCC(=O)C=C1CCC1C2CCC2(C)C1CCC2(C)O[Si](C)(C)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C28H35F5O2Si/c1-26-11-8-16(34)14-15(26)6-7-17-18(26)9-12-27(2)19(17)10-13-28(27,3)35-36(4,5)25-23(32)21(30)20(29)22(31)24(25)33/h14,17-19H,6-13H2,1-5H3 |
| InChIKey | FBCKEOJMRYSUDK-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.66 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|