C25H32O3S2 — CID 142045613
11-[4-(disulfanyloxy)phenyl]-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 142045613) has the molecular formula C25H32O3S2 and a molecular weight of 444.66 g/mol. Its IUPAC name is 11-[4-(disulfanyloxy)phenyl]-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | 11-[4-(disulfanyloxy)phenyl]-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 142045613 |
| Molecular Formula | C25H32O3S2 |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 11-[4-(disulfanyloxy)phenyl]-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC12CCC(=O)C=C1CCC1C2C(c2ccc(OSS)cc2)CC2(C)C(O)CCC12 |
| InChI | InChI=1S/C25H32O3S2/c1-24-12-11-17(26)13-16(24)5-8-19-21-9-10-22(27)25(21,2)14-20(23(19)24)15-3-6-18(7-4-15)28-30-29/h3-4,6-7,13,19-23,27,29H,5,8-12,14H2,1-2H3 |
| InChIKey | ZKZHJDHBUUGXTH-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|