C28H37NO2 — CID 176554210
(8R,11S,13S,17S)-17-acetyl-11-[4-(dimethylamino)phenyl]-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 176554210) has the molecular formula C28H37NO2 and a molecular weight of 419.61 g/mol. Its IUPAC name is (8R,11S,13S,17S)-17-acetyl-11-[4-(dimethylamino)phenyl]-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,11S,13S,17S)-17-acetyl-11-[4-(dimethylamino)phenyl]-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 176554210 |
| Molecular Formula | C28H37NO2 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | (8R,11S,13S,17S)-17-acetyl-11-[4-(dimethylamino)phenyl]-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC(=O)[C@H]1CCC2[C@@H]3CCC4=CC(=O)CCC4C3C(c3ccc(N(C)C)cc3)C[C@@]21C |
| InChI | InChI=1S/C28H37NO2/c1-17(30)25-13-14-26-23-11-7-19-15-21(31)10-12-22(19)27(23)24(16-28(25,26)2)18-5-8-20(9-6-18)29(3)4/h5-6,8-9,15,22-27H,7,10-14,16H2,1-4H3/t22?,23-,24?,25+,26?,27?,28+/m0/s1 |
| InChIKey | GNQYGBZDKMMFTB-UIKJHVPKSA-N |
| XLogP | 5.79 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|