C32H49NO2Si — CID 139756984
(7R,8S,9S,10R,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-7-[4-(dimethylamino)phenyl]-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 139756984) has the molecular formula C32H49NO2Si and a molecular weight of 507.84 g/mol. Its IUPAC name is (7R,8S,9S,10R,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-7-[4-(dimethylamino)phenyl]-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (7R,8S,9S,10R,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-7-[4-(dimethylamino)phenyl]-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 139756984 |
| Molecular Formula | C32H49NO2Si |
| Molecular Weight | 507.84 g/mol |
| Exact Mass | 507.35 |
| IUPAC Name | (7R,8S,9S,10R,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-7-[4-(dimethylamino)phenyl]-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CN(C)c1ccc([C@@H]2CC3=CC(=O)CC[C@@H]3[C@H]3CC[C@]4(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@H]4[C@@H]32)cc1 |
| InChI | InChI=1S/C32H49NO2Si/c1-31(2,3)36(7,8)35-29-16-15-28-30-26(17-18-32(28,29)4)25-14-13-24(34)19-22(25)20-27(30)21-9-11-23(12-10-21)33(5)6/h9-12,19,25-30H,13-18,20H2,1-8H3/t25-,26+,27-,28-,29-,30-,32-/m0/s1 |
| InChIKey | LZKZGYNBYQWPEH-KJRDOKGCSA-N |
| XLogP | 7.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.84 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|