C25H40O3Si — CID 23256524
(1S,2R,3R,5R,11S,12S,15S,16S)-15-[tert-butyl(dimethyl)silyl]oxy-2,16-dimethyl-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadec-7-en-6-one (PubChem CID 23256524) has the molecular formula C25H40O3Si and a molecular weight of 416.68 g/mol. Its IUPAC name is (1S,2R,3R,5R,11S,12S,15S,16S)-15-[tert-butyl(dimethyl)silyl]oxy-2,16-dimethyl-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadec-7-en-6-one.
| Compound Name | (1S,2R,3R,5R,11S,12S,15S,16S)-15-[tert-butyl(dimethyl)silyl]oxy-2,16-dimethyl-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadec-7-en-6-one |
|---|---|
| PubChem CID | 23256524 |
| Molecular Formula | C25H40O3Si |
| Molecular Weight | 416.68 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | (1S,2R,3R,5R,11S,12S,15S,16S)-15-[tert-butyl(dimethyl)silyl]oxy-2,16-dimethyl-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadec-7-en-6-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)[C@@H]5O[C@@H]5[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C25H40O3Si/c1-23(2,3)29(6,7)28-20-11-10-17-16-9-8-15-14-19(26)21-22(27-21)25(15,5)18(16)12-13-24(17,20)4/h14,16-18,20-22H,8-13H2,1-7H3/t16-,17-,18-,20-,21-,22-,24-,25-/m0/s1 |
| InChIKey | FRONSCKMIRYVHV-YEKOUOQGSA-N |
| XLogP | 5.90 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.68 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|