C26H46O2Si — CID 91749067
(5S,10S,13S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-3,10,13-trimethyl-1,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-2-one (PubChem CID 91749067) has the molecular formula C26H46O2Si and a molecular weight of 418.74 g/mol. Its IUPAC name is (5S,10S,13S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-3,10,13-trimethyl-1,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-2-one.
| Compound Name | (5S,10S,13S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-3,10,13-trimethyl-1,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-2-one |
|---|---|
| PubChem CID | 91749067 |
| Molecular Formula | C26H46O2Si |
| Molecular Weight | 418.74 g/mol |
| Exact Mass | 418.33 |
| IUPAC Name | (5S,10S,13S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-3,10,13-trimethyl-1,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-2-one |
| SMILES | CC1C[C@@H]2CCC3C4CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@]4(C)CCC3[C@@]2(C)CC1=O |
| InChI | InChI=1S/C26H46O2Si/c1-17-15-18-9-10-19-20-11-12-23(28-29(7,8)24(2,3)4)25(20,5)14-13-21(19)26(18,6)16-22(17)27/h17-21,23H,9-16H2,1-8H3/t17?,18-,19?,20?,21?,23-,25-,26-/m0/s1 |
| InChIKey | PYOFJWYFMHWUPH-RSQJQKTGSA-N |
| XLogP | 7.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.74 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|