C29H50O5Si — CID 174093594
4-[[(5R,8R,9S,10S,13S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-4-oxobutanoic acid (PubChem CID 174093594) has the molecular formula C29H50O5Si and a molecular weight of 506.80 g/mol. Its IUPAC name is 4-[[(5R,8R,9S,10S,13S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-4-oxobutanoic acid.
| Compound Name | 4-[[(5R,8R,9S,10S,13S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 174093594 |
| Molecular Formula | C29H50O5Si |
| Molecular Weight | 506.80 g/mol |
| Exact Mass | 506.34 |
| IUPAC Name | 4-[[(5R,8R,9S,10S,13S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-4-oxobutanoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC[C@@]2(C)[C@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H](OC(=O)CCC(=O)O)CC[C@@H]32)C1 |
| InChI | InChI=1S/C29H50O5Si/c1-27(2,3)35(6,7)34-20-14-16-28(4)19(18-20)8-9-21-22-10-11-24(29(22,5)17-15-23(21)28)33-26(32)13-12-25(30)31/h19-24H,8-18H2,1-7H3,(H,30,31)/t19-,20?,21+,22+,23+,24+,28+,29+/m1/s1 |
| InChIKey | RADKZXJOTBNOGU-IDKCBOSNSA-N |
| XLogP | 7.20 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.80 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|