C32H56O5Si — CID 174093596
1-O-[(5R,8R,9S,10S,13S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl] 4-O-propan-2-yl butanedioate (PubChem CID 174093596) has the molecular formula C32H56O5Si and a molecular weight of 548.88 g/mol. Its IUPAC name is 1-O-[(5R,8R,9S,10S,13S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl] 4-O-propan-2-yl butanedioate.
| Compound Name | 1-O-[(5R,8R,9S,10S,13S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl] 4-O-propan-2-yl butanedioate |
|---|---|
| PubChem CID | 174093596 |
| Molecular Formula | C32H56O5Si |
| Molecular Weight | 548.88 g/mol |
| Exact Mass | 548.39 |
| IUPAC Name | 1-O-[(5R,8R,9S,10S,13S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl] 4-O-propan-2-yl butanedioate |
| SMILES | CC(C)OC(=O)CCC(=O)O[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4CC(O[Si](C)(C)C(C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C32H56O5Si/c1-21(2)35-28(33)14-15-29(34)36-27-13-12-25-24-11-10-22-20-23(37-38(8,9)30(3,4)5)16-18-31(22,6)26(24)17-19-32(25,27)7/h21-27H,10-20H2,1-9H3/t22-,23?,24+,25+,26+,27+,31+,32+/m1/s1 |
| InChIKey | YCHKJQBTCKOECW-CLZOWTIFSA-N |
| XLogP | 8.06 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.88 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|