C27H50O3Si — CID 174093527
2-[[(5S,8R,9S,10S,13S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]ethanol (PubChem CID 174093527) has the molecular formula C27H50O3Si and a molecular weight of 450.78 g/mol. Its IUPAC name is 2-[[(5S,8R,9S,10S,13S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]ethanol.
| Compound Name | 2-[[(5S,8R,9S,10S,13S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]ethanol |
|---|---|
| PubChem CID | 174093527 |
| Molecular Formula | C27H50O3Si |
| Molecular Weight | 450.78 g/mol |
| Exact Mass | 450.35 |
| IUPAC Name | 2-[[(5S,8R,9S,10S,13S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]ethanol |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H](OCCO)CC[C@@H]32)C1 |
| InChI | InChI=1S/C27H50O3Si/c1-25(2,3)31(6,7)30-20-12-14-26(4)19(18-20)8-9-21-22-10-11-24(29-17-16-28)27(22,5)15-13-23(21)26/h19-24,28H,8-18H2,1-7H3/t19-,20?,21-,22-,23-,24-,26-,27-/m0/s1 |
| InChIKey | PEWUGBZCVBRFNT-CLMCBRBLSA-N |
| XLogP | 6.80 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.78 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|