C25H43BrOSi — CID 138453850
[(3S,5S,9S,10S,13S,14S)-17-bromo-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 138453850) has the molecular formula C25H43BrOSi and a molecular weight of 467.61 g/mol. Its IUPAC name is [(3S,5S,9S,10S,13S,14S)-17-bromo-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3S,5S,9S,10S,13S,14S)-17-bromo-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 138453850 |
| Molecular Formula | C25H43BrOSi |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | [(3S,5S,9S,10S,13S,14S)-17-bromo-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@@]2(C)[C@@H](CCC3[C@@H]2CC[C@]2(C)C(Br)=CC[C@@H]32)C1 |
| InChI | InChI=1S/C25H43BrOSi/c1-23(2,3)28(6,7)27-18-12-14-24(4)17(16-18)8-9-19-20-10-11-22(26)25(20,5)15-13-21(19)24/h11,17-21H,8-10,12-16H2,1-7H3/t17-,18-,19?,20-,21-,24-,25-/m0/s1 |
| InChIKey | ISECRVNIDHPYFA-DQENEDRPSA-N |
| XLogP | 8.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|