C28H47NO2Si — CID 10695178
(2S)-2-[(3S,5S,8R,9S,10S,13S,14S,17R)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-16-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]propanenitrile (PubChem CID 10695178) has the molecular formula C28H47NO2Si and a molecular weight of 457.78 g/mol. Its IUPAC name is (2S)-2-[(3S,5S,8R,9S,10S,13S,14S,17R)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-16-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]propanenitrile.
| Compound Name | (2S)-2-[(3S,5S,8R,9S,10S,13S,14S,17R)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-16-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]propanenitrile |
|---|---|
| PubChem CID | 10695178 |
| Molecular Formula | C28H47NO2Si |
| Molecular Weight | 457.78 g/mol |
| Exact Mass | 457.34 |
| IUPAC Name | (2S)-2-[(3S,5S,8R,9S,10S,13S,14S,17R)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-16-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]propanenitrile |
| SMILES | CC(C#N)[C@H]1C(=O)C[C@H]2[C@@H]3CC[C@H]4C[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H47NO2Si/c1-18(17-29)25-24(30)16-23-21-10-9-19-15-20(31-32(7,8)26(2,3)4)11-13-27(19,5)22(21)12-14-28(23,25)6/h18-23,25H,9-16H2,1-8H3/t18?,19-,20-,21+,22-,23-,25-,27-,28-/m0/s1 |
| InChIKey | UFVYJEZKFKPAFO-FAUUPZIISA-N |
| XLogP | 7.37 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.78 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|