C25H42O3Si — CID 101078499
(3S,3aS,6R)-3-[tert-butyl(dimethyl)silyl]oxy-3a,6-dimethyl-6-[(E)-3-oxo(2,3,4-13C3)but-1-enyl]-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-7-one (PubChem CID 101078499) has the molecular formula C25H42O3Si and a molecular weight of 421.67 g/mol. Its IUPAC name is (3S,3aS,6R)-3-[tert-butyl(dimethyl)silyl]oxy-3a,6-dimethyl-6-[(E)-3-oxo(2,3,4-13C3)but-1-enyl]-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-7-one.
| Compound Name | (3S,3aS,6R)-3-[tert-butyl(dimethyl)silyl]oxy-3a,6-dimethyl-6-[(E)-3-oxo(2,3,4-13C3)but-1-enyl]-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-7-one |
|---|---|
| PubChem CID | 101078499 |
| Molecular Formula | C25H42O3Si |
| Molecular Weight | 421.67 g/mol |
| Exact Mass | 421.30 |
| IUPAC Name | (3S,3aS,6R)-3-[tert-butyl(dimethyl)silyl]oxy-3a,6-dimethyl-6-[(E)-3-oxo(2,3,4-13C3)but-1-enyl]-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-7-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCC2C3CCC(=O)[C@](C)(/C=[13CH]/[13C]([13CH3])=O)C3CC[C@@]21C |
| InChI | InChI=1S/C25H42O3Si/c1-17(26)13-15-24(5)20-14-16-25(6)19(18(20)9-11-21(24)27)10-12-22(25)28-29(7,8)23(2,3)4/h13,15,18-20,22H,9-12,14,16H2,1-8H3/b15-13+/t18?,19?,20?,22-,24+,25-/m0/s1/i1+1,13+1,17+1 |
| InChIKey | XGKYKCIHWGFEKX-OIXDLOSPSA-N |
| XLogP | 6.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.67 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|