C25H44OSi — CID 139603690
tert-butyl-[[(5R,8R,9S,10S,13S,14S)-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-dimethylsilane (PubChem CID 139603690) has the molecular formula C25H44OSi and a molecular weight of 388.71 g/mol. Its IUPAC name is tert-butyl-[[(5R,8R,9S,10S,13S,14S)-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(5R,8R,9S,10S,13S,14S)-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 139603690 |
| Molecular Formula | C25H44OSi |
| Molecular Weight | 388.71 g/mol |
| Exact Mass | 388.32 |
| IUPAC Name | tert-butyl-[[(5R,8R,9S,10S,13S,14S)-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC[C@H]2[C@@H]3CC[C@@H]4C=CCC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C25H44OSi/c1-23(2,3)27(6,7)26-22-14-13-20-19-12-11-18-10-8-9-16-24(18,4)21(19)15-17-25(20,22)5/h8,10,18-22H,9,11-17H2,1-7H3/t18-,19-,20-,21-,22?,24-,25-/m0/s1 |
| InChIKey | NOEOBFUDNUPXHD-WVBRLFSISA-N |
| XLogP | 7.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.71 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|