C28H52O2Si — CID 11362888
(3S,8R,9S,10S,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-3-propyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 11362888) has the molecular formula C28H52O2Si and a molecular weight of 448.81 g/mol. Its IUPAC name is (3S,8R,9S,10S,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-3-propyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8R,9S,10S,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-3-propyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 11362888 |
| Molecular Formula | C28H52O2Si |
| Molecular Weight | 448.81 g/mol |
| Exact Mass | 448.37 |
| IUPAC Name | (3S,8R,9S,10S,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-3-propyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CCC[C@]1(O)CC[C@@]2(C)C(CC[C@H]3[C@@H]4CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C28H52O2Si/c1-9-15-28(29)18-17-26(5)20(19-28)10-11-21-22-12-13-24(27(22,6)16-14-23(21)26)30-31(7,8)25(2,3)4/h20-24,29H,9-19H2,1-8H3/t20?,21-,22-,23-,24-,26-,27-,28-/m0/s1 |
| InChIKey | LNLBOFSRMDGVBG-OOKGLGNDSA-N |
| XLogP | 7.95 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.81 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|