C22H36O2 — CID 10404549
(3R,10S,13S)-3-hydroxy-10,13-dimethyl-3-propyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 10404549) has the molecular formula C22H36O2 and a molecular weight of 332.53 g/mol. Its IUPAC name is (3R,10S,13S)-3-hydroxy-10,13-dimethyl-3-propyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (3R,10S,13S)-3-hydroxy-10,13-dimethyl-3-propyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 10404549 |
| Molecular Formula | C22H36O2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | (3R,10S,13S)-3-hydroxy-10,13-dimethyl-3-propyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | CCC[C@@]1(O)CC[C@@]2(C)C(CCC3C2CC[C@]2(C)C(=O)CCC32)C1 |
| InChI | InChI=1S/C22H36O2/c1-4-10-22(24)13-12-20(2)15(14-22)5-6-16-17-7-8-19(23)21(17,3)11-9-18(16)20/h15-18,24H,4-14H2,1-3H3/t15?,16?,17?,18?,20-,21-,22+/m0/s1 |
| InChIKey | DLNYBTQCUMZHIJ-IDSKFFGRSA-N |
| XLogP | 5.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |