C31H53NO3 — CID 101165256
N-hexyl-N-[[(3R,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]methyl]pentanamide (PubChem CID 101165256) has the molecular formula C31H53NO3 and a molecular weight of 487.77 g/mol. Its IUPAC name is N-hexyl-N-[[(3R,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]methyl]pentanamide.
| Compound Name | N-hexyl-N-[[(3R,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]methyl]pentanamide |
|---|---|
| PubChem CID | 101165256 |
| Molecular Formula | C31H53NO3 |
| Molecular Weight | 487.77 g/mol |
| Exact Mass | 487.40 |
| IUPAC Name | N-hexyl-N-[[(3R,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]methyl]pentanamide |
| SMILES | CCCCCCN(C[C@@]1(O)CC[C@@]2(C)C(CC[C@@H]3[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]32)C1)C(=O)CCCC |
| InChI | InChI=1S/C31H53NO3/c1-5-7-9-10-20-32(28(34)11-8-6-2)22-31(35)19-18-29(3)23(21-31)12-13-24-25-14-15-27(33)30(25,4)17-16-26(24)29/h23-26,35H,5-22H2,1-4H3/t23?,24-,25-,26-,29-,30-,31+/m0/s1 |
| InChIKey | DPBYTCDNAPDXSO-VFFNVIJRSA-N |
| XLogP | 6.93 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.77 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|