C30H48ClNO3 — CID 11813157
3-chloro-N-(cyclohexylmethyl)-N-[[(3R,5S,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]methyl]propanamide (PubChem CID 11813157) has the molecular formula C30H48ClNO3 and a molecular weight of 506.17 g/mol. Its IUPAC name is 3-chloro-N-(cyclohexylmethyl)-N-[[(3R,5S,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]methyl]propanamide.
| Compound Name | 3-chloro-N-(cyclohexylmethyl)-N-[[(3R,5S,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]methyl]propanamide |
|---|---|
| PubChem CID | 11813157 |
| Molecular Formula | C30H48ClNO3 |
| Molecular Weight | 506.17 g/mol |
| Exact Mass | 505.33 |
| IUPAC Name | 3-chloro-N-(cyclohexylmethyl)-N-[[(3R,5S,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]methyl]propanamide |
| SMILES | C[C@]12CC[C@](O)(CN(CC3CCCCC3)C(=O)CCCl)C[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C30H48ClNO3/c1-28-15-16-30(35,20-32(27(34)13-17-31)19-21-6-4-3-5-7-21)18-22(28)8-9-23-24-10-11-26(33)29(24,2)14-12-25(23)28/h21-25,35H,3-20H2,1-2H3/t22-,23-,24-,25-,28-,29-,30+/m0/s1 |
| InChIKey | UPFBXIQFWKZJJE-FOSHRBNYSA-N |
| XLogP | 6.37 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.17 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|