C25H37Cl2NO3 — CID 11048967
2,2-dichloro-N-[[(3R,5S,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]methyl]-N-prop-2-enylacetamide (PubChem CID 11048967) has the molecular formula C25H37Cl2NO3 and a molecular weight of 470.48 g/mol. Its IUPAC name is 2,2-dichloro-N-[[(3R,5S,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]methyl]-N-prop-2-enylacetamide.
| Compound Name | 2,2-dichloro-N-[[(3R,5S,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]methyl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 11048967 |
| Molecular Formula | C25H37Cl2NO3 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | 2,2-dichloro-N-[[(3R,5S,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]methyl]-N-prop-2-enylacetamide |
| SMILES | C=CCN(C[C@@]1(O)CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]32)C1)C(=O)C(Cl)Cl |
| InChI | InChI=1S/C25H37Cl2NO3/c1-4-13-28(22(30)21(26)27)15-25(31)12-11-23(2)16(14-25)5-6-17-18-7-8-20(29)24(18,3)10-9-19(17)23/h4,16-19,21,31H,1,5-15H2,2-3H3/t16-,17-,18-,19-,23-,24-,25+/m0/s1 |
| InChIKey | DCBFDKAACWBBHI-ODPOYXBCSA-N |
| XLogP | 5.15 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|