C33H55NO3 — CID 10907388
N-[[(3R,5S,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]methyl]-N-nonylcyclopropanecarboxamide (PubChem CID 10907388) has the molecular formula C33H55NO3 and a molecular weight of 513.81 g/mol. Its IUPAC name is N-[[(3R,5S,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]methyl]-N-nonylcyclopropanecarboxamide.
| Compound Name | N-[[(3R,5S,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]methyl]-N-nonylcyclopropanecarboxamide |
|---|---|
| PubChem CID | 10907388 |
| Molecular Formula | C33H55NO3 |
| Molecular Weight | 513.81 g/mol |
| Exact Mass | 513.42 |
| IUPAC Name | N-[[(3R,5S,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]methyl]-N-nonylcyclopropanecarboxamide |
| SMILES | CCCCCCCCCN(C[C@@]1(O)CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]32)C1)C(=O)C1CC1 |
| InChI | InChI=1S/C33H55NO3/c1-4-5-6-7-8-9-10-21-34(30(36)24-11-12-24)23-33(37)20-19-31(2)25(22-33)13-14-26-27-15-16-29(35)32(27,3)18-17-28(26)31/h24-28,37H,4-23H2,1-3H3/t25-,26-,27-,28-,31-,32-,33+/m0/s1 |
| InChIKey | GDXZGVWFHWLBLG-ZJHSDCFHSA-N |
| XLogP | 7.32 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.81 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|