C28H49NO2 — CID 11144514
(3R,5S,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-3-[(octylamino)methyl]-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 11144514) has the molecular formula C28H49NO2 and a molecular weight of 431.71 g/mol. Its IUPAC name is (3R,5S,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-3-[(octylamino)methyl]-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (3R,5S,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-3-[(octylamino)methyl]-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 11144514 |
| Molecular Formula | C28H49NO2 |
| Molecular Weight | 431.71 g/mol |
| Exact Mass | 431.38 |
| IUPAC Name | (3R,5S,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-3-[(octylamino)methyl]-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | CCCCCCCCNC[C@@]1(O)CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]32)C1 |
| InChI | InChI=1S/C28H49NO2/c1-4-5-6-7-8-9-18-29-20-28(31)17-16-26(2)21(19-28)10-11-22-23-12-13-25(30)27(23,3)15-14-24(22)26/h21-24,29,31H,4-20H2,1-3H3/t21-,22-,23-,24-,26-,27-,28+/m0/s1 |
| InChIKey | CMMZHROXJSCRJZ-CCHFCTFWSA-N |
| XLogP | 6.28 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.71 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|