C28H51NO3Si — CID 90073365
(8R,9R,10S,13S,14S)-3-[[2-[tert-butyl(dimethyl)silyl]oxyethylamino]methyl]-3-hydroxy-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 90073365) has the molecular formula C28H51NO3Si and a molecular weight of 477.81 g/mol. Its IUPAC name is (8R,9R,10S,13S,14S)-3-[[2-[tert-butyl(dimethyl)silyl]oxyethylamino]methyl]-3-hydroxy-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9R,10S,13S,14S)-3-[[2-[tert-butyl(dimethyl)silyl]oxyethylamino]methyl]-3-hydroxy-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 90073365 |
| Molecular Formula | C28H51NO3Si |
| Molecular Weight | 477.81 g/mol |
| Exact Mass | 477.36 |
| IUPAC Name | (8R,9R,10S,13S,14S)-3-[[2-[tert-butyl(dimethyl)silyl]oxyethylamino]methyl]-3-hydroxy-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCNCC1(O)CC[C@@]2(C)C(CC[C@@H]3[C@H]2CC[C@]2(C)C(=O)CC[C@@H]32)C1 |
| InChI | InChI=1S/C28H51NO3Si/c1-25(2,3)33(6,7)32-17-16-29-19-28(31)15-14-26(4)20(18-28)8-9-21-22-10-11-24(30)27(22,5)13-12-23(21)26/h20-23,29,31H,8-19H2,1-7H3/t20?,21-,22-,23+,26-,27-,28?/m0/s1 |
| InChIKey | XHXZCBICJHULFH-ZFHYPUFOSA-N |
| XLogP | 5.94 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.81 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|