C37H65NO3 — CID 10918848
N-decyl-N-[[(3R,5S,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]methyl]heptanamide (PubChem CID 10918848) has the molecular formula C37H65NO3 and a molecular weight of 571.93 g/mol. Its IUPAC name is N-decyl-N-[[(3R,5S,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]methyl]heptanamide.
| Compound Name | N-decyl-N-[[(3R,5S,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]methyl]heptanamide |
|---|---|
| PubChem CID | 10918848 |
| Molecular Formula | C37H65NO3 |
| Molecular Weight | 571.93 g/mol |
| Exact Mass | 571.50 |
| IUPAC Name | N-decyl-N-[[(3R,5S,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]methyl]heptanamide |
| SMILES | CCCCCCCCCCN(C[C@@]1(O)CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]32)C1)C(=O)CCCCCC |
| InChI | InChI=1S/C37H65NO3/c1-5-7-9-11-12-13-14-16-26-38(34(40)17-15-10-8-6-2)28-37(41)25-24-35(3)29(27-37)18-19-30-31-20-21-33(39)36(31,4)23-22-32(30)35/h29-32,41H,5-28H2,1-4H3/t29-,30-,31-,32-,35-,36-,37+/m0/s1 |
| InChIKey | GFIKWWJYCDPXKL-GQSQZBBVSA-N |
| XLogP | 9.27 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.93 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|