C29H47NO4 — CID 11005230
N-(3-ethoxypropyl)-N-[[(3R,5S,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]methyl]cyclopropanecarboxamide (PubChem CID 11005230) has the molecular formula C29H47NO4 and a molecular weight of 473.70 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-N-[[(3R,5S,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]methyl]cyclopropanecarboxamide.
| Compound Name | N-(3-ethoxypropyl)-N-[[(3R,5S,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]methyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 11005230 |
| Molecular Formula | C29H47NO4 |
| Molecular Weight | 473.70 g/mol |
| Exact Mass | 473.35 |
| IUPAC Name | N-(3-ethoxypropyl)-N-[[(3R,5S,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]methyl]cyclopropanecarboxamide |
| SMILES | CCOCCCN(C[C@@]1(O)CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]32)C1)C(=O)C1CC1 |
| InChI | InChI=1S/C29H47NO4/c1-4-34-17-5-16-30(26(32)20-6-7-20)19-29(33)15-14-27(2)21(18-29)8-9-22-23-10-11-25(31)28(23,3)13-12-24(22)27/h20-24,33H,4-19H2,1-3H3/t21-,22-,23-,24-,27-,28-,29+/m0/s1 |
| InChIKey | PCRRPQJJFXBMCM-BMFXWLQISA-N |
| XLogP | 4.99 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.70 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|