C24H42O3 — CID 123387042
17-(2-hydroxy-2-methylpropoxy)-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 123387042) has the molecular formula C24H42O3 and a molecular weight of 378.60 g/mol. Its IUPAC name is 17-(2-hydroxy-2-methylpropoxy)-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | 17-(2-hydroxy-2-methylpropoxy)-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 123387042 |
| Molecular Formula | C24H42O3 |
| Molecular Weight | 378.60 g/mol |
| Exact Mass | 378.31 |
| IUPAC Name | 17-(2-hydroxy-2-methylpropoxy)-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC(C)(O)COC1CCC2C3CCC4CC(C)(O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C24H42O3/c1-21(2,25)15-27-20-9-8-18-17-7-6-16-14-22(3,26)12-13-23(16,4)19(17)10-11-24(18,20)5/h16-20,25-26H,6-15H2,1-5H3 |
| InChIKey | IVUAKCAXQWXMJY-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.60 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |