C28H50O2 — CID 123144288
17-(4-hydroxy-4,5-dimethylhexyl)-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 123144288) has the molecular formula C28H50O2 and a molecular weight of 418.71 g/mol. Its IUPAC name is 17-(4-hydroxy-4,5-dimethylhexyl)-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | 17-(4-hydroxy-4,5-dimethylhexyl)-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 123144288 |
| Molecular Formula | C28H50O2 |
| Molecular Weight | 418.71 g/mol |
| Exact Mass | 418.38 |
| IUPAC Name | 17-(4-hydroxy-4,5-dimethylhexyl)-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC(C)C(C)(O)CCCC1CCC2C3CCC4CC(C)(O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C28H50O2/c1-19(2)28(6,30)14-7-8-20-10-12-23-22-11-9-21-18-25(3,29)16-17-27(21,5)24(22)13-15-26(20,23)4/h19-24,29-30H,7-18H2,1-6H3 |
| InChIKey | FZPJKRRTVDKPCJ-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.71 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |