C28H48O2 — CID 138510907
(3S,10S)-17-(5-hydroxyoct-7-enyl)-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 138510907) has the molecular formula C28H48O2 and a molecular weight of 416.69 g/mol. Its IUPAC name is (3S,10S)-17-(5-hydroxyoct-7-enyl)-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,10S)-17-(5-hydroxyoct-7-enyl)-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 138510907 |
| Molecular Formula | C28H48O2 |
| Molecular Weight | 416.69 g/mol |
| Exact Mass | 416.37 |
| IUPAC Name | (3S,10S)-17-(5-hydroxyoct-7-enyl)-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | C=CCC(O)CCCCC1CCC2C3CCC4C[C@@](C)(O)CC[C@]4(C)C3CCC12C |
| InChI | InChI=1S/C28H48O2/c1-5-8-22(29)10-7-6-9-20-12-14-24-23-13-11-21-19-26(2,30)17-18-28(21,4)25(23)15-16-27(20,24)3/h5,20-25,29-30H,1,6-19H2,2-4H3/t20?,21?,22?,23?,24?,25?,26-,27?,28-/m0/s1 |
| InChIKey | LXOOSMMKFPXTOF-FCADNDASSA-N |
| XLogP | 6.89 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.69 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|