C29H52O3 — CID 144728649
(3S)-17-[(2R)-5-hydroxy-8-methoxyoctan-2-yl]-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 144728649) has the molecular formula C29H52O3 and a molecular weight of 448.73 g/mol. Its IUPAC name is (3S)-17-[(2R)-5-hydroxy-8-methoxyoctan-2-yl]-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S)-17-[(2R)-5-hydroxy-8-methoxyoctan-2-yl]-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 144728649 |
| Molecular Formula | C29H52O3 |
| Molecular Weight | 448.73 g/mol |
| Exact Mass | 448.39 |
| IUPAC Name | (3S)-17-[(2R)-5-hydroxy-8-methoxyoctan-2-yl]-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | COCCCC(O)CC[C@@H](C)C1CCC2C3CCC4C[C@@](C)(O)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C29H52O3/c1-20(8-10-22(30)7-6-18-32-5)24-12-13-25-23-11-9-21-19-27(2,31)16-17-28(21,3)26(23)14-15-29(24,25)4/h20-26,30-31H,6-19H2,1-5H3/t20-,21?,22?,23?,24?,25?,26?,27+,28?,29?/m1/s1 |
| InChIKey | HKQWWHJFRCOPLO-ZGBJTJIOSA-N |
| XLogP | 6.60 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.73 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|