C28H50O — CID 154792784
(3S,5S)-3,10,13-trimethyl-17-(6-methylheptan-2-yl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 154792784) has the molecular formula C28H50O and a molecular weight of 402.71 g/mol. Its IUPAC name is (3S,5S)-3,10,13-trimethyl-17-(6-methylheptan-2-yl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,5S)-3,10,13-trimethyl-17-(6-methylheptan-2-yl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 154792784 |
| Molecular Formula | C28H50O |
| Molecular Weight | 402.71 g/mol |
| Exact Mass | 402.39 |
| IUPAC Name | (3S,5S)-3,10,13-trimethyl-17-(6-methylheptan-2-yl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC[C@H]4C[C@@](C)(O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C28H50O/c1-19(2)8-7-9-20(3)23-12-13-24-22-11-10-21-18-26(4,29)16-17-27(21,5)25(22)14-15-28(23,24)6/h19-25,29H,7-18H2,1-6H3/t20?,21-,22?,23?,24?,25?,26-,27?,28?/m0/s1 |
| InChIKey | OSPYNJYSTBNWEX-HPHSSFRFSA-N |
| XLogP | 7.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.71 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |