C54H92O4 — CID 10795461
CID 10795461 (PubChem CID 10795461) has the molecular formula C54H92O4 and a molecular weight of 805.33 g/mol.
| Compound Name | CID 10795461 |
|---|---|
| PubChem CID | 10795461 |
| Molecular Formula | C54H92O4 |
| Molecular Weight | 805.33 g/mol |
| Exact Mass | 804.70 |
| IUPAC Name | — |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4CC5(CC[C@]4(C)[C@H]3CC[C@]12C)OOC1(CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@@H]32)C1)OO5 |
| InChI | InChI=1S/C54H92O4/c1-35(2)13-11-15-37(5)43-21-23-45-41-19-17-39-33-53(31-29-49(39,7)47(41)25-27-51(43,45)9)55-57-54(58-56-53)32-30-50(8)40(34-54)18-20-42-46-24-22-44(38(6)16-12-14-36(3)4)52(46,10)28-26-48(42)50/h35-48H,11-34H2,1-10H3/t37-,38-,39+,40+,41+,42+,43-,44-,45+,46+,47+,48+,49+,50+,51-,52-,53?,54?/m1/s1 |
| InChIKey | FFVWOHFZRUYDBU-VHOSVOKYSA-N |
| XLogP | 15.53 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.33 |
| LogP ≤ 5 | 15.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|