C33H56O — CID 102194275
CID 102194275 (PubChem CID 102194275) has the molecular formula C33H56O and a molecular weight of 468.81 g/mol.
| Compound Name | CID 102194275 |
|---|---|
| PubChem CID | 102194275 |
| Molecular Formula | C33H56O |
| Molecular Weight | 468.81 g/mol |
| Exact Mass | 468.43 |
| IUPAC Name | — |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4CC5(CC[C@]4(C)[C@H]3CC[C@]12C)CC1(CCOC1)C5 |
| InChI | InChI=1S/C33H56O/c1-23(2)7-6-8-24(3)27-11-12-28-26-10-9-25-19-32(20-33(21-32)17-18-34-22-33)16-15-30(25,4)29(26)13-14-31(27,28)5/h23-29H,6-22H2,1-5H3/t24-,25+,26+,27-,28+,29+,30+,31-,32?,33?/m1/s1 |
| InChIKey | NVSGPIYNIHPRQK-JKUPTRKNSA-N |
| XLogP | 9.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.81 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |