C31H54IO+ — CID 10437954
(3R,5S,8R,9S,10S,13R,14S,17R)-3-[2-(iodoniacycloprop-2-yl)ethyl]-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 10437954) has the molecular formula C31H54IO+ and a molecular weight of 569.68 g/mol. Its IUPAC name is (3R,5S,8R,9S,10S,13R,14S,17R)-3-[2-(iodoniacycloprop-2-yl)ethyl]-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,5S,8R,9S,10S,13R,14S,17R)-3-[2-(iodoniacycloprop-2-yl)ethyl]-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 10437954 |
| Molecular Formula | C31H54IO+ |
| Molecular Weight | 569.68 g/mol |
| Exact Mass | 569.32 |
| IUPAC Name | (3R,5S,8R,9S,10S,13R,14S,17R)-3-[2-(iodoniacycloprop-2-yl)ethyl]-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@](O)(CCC5C[I+]5)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C31H54IO/c1-21(2)7-6-8-22(3)26-11-12-27-25-10-9-23-19-31(33,16-13-24-20-32-24)18-17-29(23,4)28(25)14-15-30(26,27)5/h21-28,33H,6-20H2,1-5H3/q+1/t22-,23+,24?,25+,26-,27+,28+,29+,30-,31+/m1/s1 |
| InChIKey | ONZALOAGUCEZIO-HNNAMFRBSA-N |
| XLogP | 5.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.68 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|