C31H56O — CID 154792806
3-butyl-10,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 154792806) has the molecular formula C31H56O and a molecular weight of 444.79 g/mol. Its IUPAC name is 3-butyl-10,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | 3-butyl-10,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 154792806 |
| Molecular Formula | C31H56O |
| Molecular Weight | 444.79 g/mol |
| Exact Mass | 444.43 |
| IUPAC Name | 3-butyl-10,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CCCCC1(O)CCC2(C)C(CCC3C2CCC2(C)C(C(C)CCCC(C)C)CCC32)C1 |
| InChI | InChI=1S/C31H56O/c1-7-8-17-31(32)20-19-29(5)24(21-31)12-13-25-27-15-14-26(23(4)11-9-10-22(2)3)30(27,6)18-16-28(25)29/h22-28,32H,7-21H2,1-6H3 |
| InChIKey | WUMIKILQVVXGKN-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.79 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |