C25H42O2 — CID 123786888
5-(3-hydroxy-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pentan-2-one (PubChem CID 123786888) has the molecular formula C25H42O2 and a molecular weight of 374.61 g/mol. Its IUPAC name is 5-(3-hydroxy-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pentan-2-one.
| Compound Name | 5-(3-hydroxy-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pentan-2-one |
|---|---|
| PubChem CID | 123786888 |
| Molecular Formula | C25H42O2 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.32 |
| IUPAC Name | 5-(3-hydroxy-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pentan-2-one |
| SMILES | CC(=O)CCCC1CCC2C3CCC4CC(C)(O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C25H42O2/c1-17(26)6-5-7-18-9-11-21-20-10-8-19-16-23(2,27)14-15-25(19,4)22(20)12-13-24(18,21)3/h18-22,27H,5-16H2,1-4H3 |
| InChIKey | LJZSWJYAUITDAX-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |