C28H47F3O — CID 170249359
(3S)-17-(5,5-dimethylhexyl)-10,13-dimethyl-3-(trifluoromethyl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 170249359) has the molecular formula C28H47F3O and a molecular weight of 456.68 g/mol. Its IUPAC name is (3S)-17-(5,5-dimethylhexyl)-10,13-dimethyl-3-(trifluoromethyl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S)-17-(5,5-dimethylhexyl)-10,13-dimethyl-3-(trifluoromethyl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 170249359 |
| Molecular Formula | C28H47F3O |
| Molecular Weight | 456.68 g/mol |
| Exact Mass | 456.36 |
| IUPAC Name | (3S)-17-(5,5-dimethylhexyl)-10,13-dimethyl-3-(trifluoromethyl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC(C)(C)CCCCC1CCC2C3CCC4C[C@](O)(C(F)(F)F)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C28H47F3O/c1-24(2,3)14-7-6-8-19-10-12-22-21-11-9-20-18-27(32,28(29,30)31)17-16-26(20,5)23(21)13-15-25(19,22)4/h19-23,32H,6-18H2,1-5H3/t19?,20?,21?,22?,23?,25?,26?,27-/m0/s1 |
| InChIKey | YAFZDVBRTKBYGS-ZFPFLEESSA-N |
| XLogP | 8.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.68 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|