C31H56O2Si — CID 174138899
(3R,5R,8S,9S,10S,13S,14S,17R)-11-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-17-prop-1-en-2-yl-3-propyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 174138899) has the molecular formula C31H56O2Si and a molecular weight of 488.87 g/mol. Its IUPAC name is (3R,5R,8S,9S,10S,13S,14S,17R)-11-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-17-prop-1-en-2-yl-3-propyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,5R,8S,9S,10S,13S,14S,17R)-11-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-17-prop-1-en-2-yl-3-propyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 174138899 |
| Molecular Formula | C31H56O2Si |
| Molecular Weight | 488.87 g/mol |
| Exact Mass | 488.40 |
| IUPAC Name | (3R,5R,8S,9S,10S,13S,14S,17R)-11-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-17-prop-1-en-2-yl-3-propyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | C=C(C)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@@](O)(CCC)CC[C@]4(C)[C@H]3C(O[Si](C)(C)C(C)(C)C)C[C@]12C |
| InChI | InChI=1S/C31H56O2Si/c1-11-16-31(32)18-17-29(7)22(19-31)12-13-23-25-15-14-24(21(2)3)30(25,8)20-26(27(23)29)33-34(9,10)28(4,5)6/h22-27,32H,2,11-20H2,1,3-10H3/t22-,23+,24-,25+,26?,27-,29+,30-,31-/m1/s1 |
| InChIKey | IDDWZVATHPZQMC-FISIBKAKSA-N |
| XLogP | 8.75 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.87 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|