C24H37IO4 — CID 88780250
[(8S,9S,10S,13S,14S,17S)-17-acetyl-3-hydroxy-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-yl] 2-iodoacetate (PubChem CID 88780250) has the molecular formula C24H37IO4 and a molecular weight of 516.46 g/mol. Its IUPAC name is [(8S,9S,10S,13S,14S,17S)-17-acetyl-3-hydroxy-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-yl] 2-iodoacetate.
| Compound Name | [(8S,9S,10S,13S,14S,17S)-17-acetyl-3-hydroxy-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-yl] 2-iodoacetate |
|---|---|
| PubChem CID | 88780250 |
| Molecular Formula | C24H37IO4 |
| Molecular Weight | 516.46 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | [(8S,9S,10S,13S,14S,17S)-17-acetyl-3-hydroxy-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-11-yl] 2-iodoacetate |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3CCC4CC(C)(O)CC[C@]4(C)[C@H]3C(OC(=O)CI)C[C@]12C |
| InChI | InChI=1S/C24H37IO4/c1-14(26)17-7-8-18-16-6-5-15-11-22(2,28)9-10-23(15,3)21(16)19(12-24(17,18)4)29-20(27)13-25/h15-19,21,28H,5-13H2,1-4H3/t15?,16-,17+,18-,19?,21+,22?,23-,24+/m0/s1 |
| InChIKey | HLOCIPXOGYAWIS-SWTJSLGFSA-N |
| XLogP | 4.94 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|