C28H45NO4 — CID 88778270
[(1S,2S,11S,12S,15S,16S)-15-acetyl-2,16-dimethyl-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecan-18-yl] 2-[butyl(methyl)amino]acetate (PubChem CID 88778270) has the molecular formula C28H45NO4 and a molecular weight of 459.67 g/mol. Its IUPAC name is [(1S,2S,11S,12S,15S,16S)-15-acetyl-2,16-dimethyl-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecan-18-yl] 2-[butyl(methyl)amino]acetate.
| Compound Name | [(1S,2S,11S,12S,15S,16S)-15-acetyl-2,16-dimethyl-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecan-18-yl] 2-[butyl(methyl)amino]acetate |
|---|---|
| PubChem CID | 88778270 |
| Molecular Formula | C28H45NO4 |
| Molecular Weight | 459.67 g/mol |
| Exact Mass | 459.33 |
| IUPAC Name | [(1S,2S,11S,12S,15S,16S)-15-acetyl-2,16-dimethyl-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecan-18-yl] 2-[butyl(methyl)amino]acetate |
| SMILES | CCCCN(C)CC(=O)OC1C[C@]2(C)[C@@H](C(C)=O)CC[C@H]2[C@@H]2CCC3CC4OC4C[C@]3(C)[C@@H]12 |
| InChI | InChI=1S/C28H45NO4/c1-6-7-12-29(5)16-25(31)33-24-15-28(4)20(17(2)30)10-11-21(28)19-9-8-18-13-22-23(32-22)14-27(18,3)26(19)24/h18-24,26H,6-16H2,1-5H3/t18?,19-,20+,21-,22?,23?,24?,26+,27-,28+/m0/s1 |
| InChIKey | XJZHNSKOVRRIEC-BEFNQQOJSA-N |
| XLogP | 4.87 |
| TPSA | 59.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.67 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|