C21H33NO3 — CID 88747290
methyl (1R,2S,11S,12S,16S)-18-amino-2,16-dimethyl-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecane-15-carboxylate (PubChem CID 88747290) has the molecular formula C21H33NO3 and a molecular weight of 347.50 g/mol. Its IUPAC name is methyl (1R,2S,11S,12S,16S)-18-amino-2,16-dimethyl-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecane-15-carboxylate.
| Compound Name | methyl (1R,2S,11S,12S,16S)-18-amino-2,16-dimethyl-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecane-15-carboxylate |
|---|---|
| PubChem CID | 88747290 |
| Molecular Formula | C21H33NO3 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.25 |
| IUPAC Name | methyl (1R,2S,11S,12S,16S)-18-amino-2,16-dimethyl-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecane-15-carboxylate |
| SMILES | COC(=O)C1CC[C@H]2[C@@H]3CCC4CC5OC5C[C@]4(C)[C@@H]3C(N)C[C@]12C |
| InChI | InChI=1S/C21H33NO3/c1-20-10-17-16(25-17)8-11(20)4-5-12-13-6-7-14(19(23)24-3)21(13,2)9-15(22)18(12)20/h11-18H,4-10,22H2,1-3H3/t11?,12-,13-,14?,15?,16?,17?,18-,20-,21-/m0/s1 |
| InChIKey | QZHNMVWOPDUNPN-YXRIDDETSA-N |
| XLogP | 3.13 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|