C25H38Cl3NO6 — CID 70543300
methyl (8S,9R,10S,13S,14S)-3-hydroxy-2-methoxy-10,13-dimethyl-11-(2,2,2-trichloroethoxycarbonylamino)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate (PubChem CID 70543300) has the molecular formula C25H38Cl3NO6 and a molecular weight of 554.94 g/mol. Its IUPAC name is methyl (8S,9R,10S,13S,14S)-3-hydroxy-2-methoxy-10,13-dimethyl-11-(2,2,2-trichloroethoxycarbonylamino)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate.
| Compound Name | methyl (8S,9R,10S,13S,14S)-3-hydroxy-2-methoxy-10,13-dimethyl-11-(2,2,2-trichloroethoxycarbonylamino)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate |
|---|---|
| PubChem CID | 70543300 |
| Molecular Formula | C25H38Cl3NO6 |
| Molecular Weight | 554.94 g/mol |
| Exact Mass | 553.18 |
| IUPAC Name | methyl (8S,9R,10S,13S,14S)-3-hydroxy-2-methoxy-10,13-dimethyl-11-(2,2,2-trichloroethoxycarbonylamino)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate |
| SMILES | COC(=O)C1CC[C@H]2[C@@H]3CCC4CC(O)C(OC)C[C@]4(C)[C@@H]3C(NC(=O)OCC(Cl)(Cl)Cl)C[C@]12C |
| InChI | InChI=1S/C25H38Cl3NO6/c1-23-11-19(33-3)18(30)9-13(23)5-6-14-15-7-8-16(21(31)34-4)24(15,2)10-17(20(14)23)29-22(32)35-12-25(26,27)28/h13-20,30H,5-12H2,1-4H3,(H,29,32)/t13?,14-,15-,16?,17?,18?,19?,20-,23-,24-/m0/s1 |
| InChIKey | SSSAOJFZNJBXJB-KKWXQJQVSA-N |
| XLogP | 4.88 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.94 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|